Product Information:
| Cat. No.: EX-A15390 | Purity: >98% |
![]() | |
| Chemical structure of OD36 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2387510-88-3 |
|---|---|
| Purity | >98% |
| Formula | C16H16Cl2N4O2 |
| Mol Weight | 367.23 |
| Reference: | |
| CoA | CoA of OD36 hydrochloride |
| Smiles: | C1COCCOC2=CC(=CC(=C2)C3=C4N=C(N1)C=CN4N=C3)Cl.Cl |
|---|
KEYWORDS: buy OD36 hydrochloride | OD36 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 2387510-88-3 | 2387510-88-3 supplier


Inhibitor Specialist
